EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24O5 |
| Net Charge | 0 |
| Average Mass | 296.363 |
| Monoisotopic Mass | 296.16237 |
| SMILES | CC(=O)O[C@H](C)CCC/C=C/C[C@H](O)/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C16H24O5/c1-13(21-14(2)17)9-5-3-4-6-10-15(18)11-7-8-12-16(19)20/h4,6-8,11-13,15,18H,3,5,9-10H2,1-2H3,(H,19,20)/b6-4+,11-7+,12-8+/t13-,15+/m1/s1 |
| InChIKey | CFFRJDASPYBVKV-XMUXOCQBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycosphaerella rubella (ncbitaxon:179339) | - | PubMed (9654778) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,4E,6S,8E,13R)-13-acetyloxy-6-hydroxytetradeca-2,4,8-trienoic acid (CHEBI:215505) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (2E,4E,6S,8E,13R)-13-acetyloxy-6-hydroxytetradeca-2,4,8-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 26669205 | ChemSpider |