EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28939 - N-acetyl-L-cysteine
| Formula | C5H9NO3S |
| Net Charge | 0 |
| Average Mass | 163.198 |
| Monoisotopic Mass | 163.03031 |
| SMILES | CC(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C5H9NO3S/c1-3(7)6-4(2-10)5(8)9/h4,10H,2H2,1H3,(H,6,7)(H,8,9)/t4-/m0/s1 |
| InChIKey | PWKSKIMOESPYIA-BYPYZUCNSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| - | MetaboLights (MTBLS172) |
| Roles Classification |
|---|
| Chemical Roles: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antidote to paracetamol poisoning A role borne by a molecule that acts to counteract or neutralize the deleterious effects of paracetamol (acetaminophen). geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. vulnerary A drug used in treating and healing of wounds. mucolytic A compound that alters the structure of mucus so as to decrease its viscosity and thereby facilitate its removal by ciliary action and expectoration. Compare with antitussives, which suppress the cough reflex, and expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-cysteine (CHEBI:28939) has role antidote to paracetamol poisoning (CHEBI:74529) |
| N-acetyl-L-cysteine (CHEBI:28939) has role antiinfective agent (CHEBI:35441) |
| N-acetyl-L-cysteine (CHEBI:28939) has role antioxidant (CHEBI:22586) |
| N-acetyl-L-cysteine (CHEBI:28939) has role antiviral drug (CHEBI:36044) |
| N-acetyl-L-cysteine (CHEBI:28939) has role ferroptosis inhibitor (CHEBI:173084) |
| N-acetyl-L-cysteine (CHEBI:28939) has role geroprotector (CHEBI:176497) |
| N-acetyl-L-cysteine (CHEBI:28939) has role human metabolite (CHEBI:77746) |
| N-acetyl-L-cysteine (CHEBI:28939) has role mucolytic (CHEBI:77034) |
| N-acetyl-L-cysteine (CHEBI:28939) has role radical scavenger (CHEBI:48578) |
| N-acetyl-L-cysteine (CHEBI:28939) has role vulnerary (CHEBI:73336) |
| N-acetyl-L-cysteine (CHEBI:28939) is a N-acetyl-L-amino acid (CHEBI:21545) |
| N-acetyl-L-cysteine (CHEBI:28939) is a L-cysteine derivative (CHEBI:83824) |
| N-acetyl-L-cysteine (CHEBI:28939) is a acetylcysteine (CHEBI:22198) |
| N-acetyl-L-cysteine (CHEBI:28939) is conjugate acid of N-acetyl-L-cysteinate (CHEBI:78236) |
| Incoming Relation(s) |
| S-substituted N-acetyl-L-cysteine (CHEBI:47911) has functional parent N-acetyl-L-cysteine (CHEBI:28939) |
| N-acetyl-L-cysteinate (CHEBI:78236) is conjugate base of N-acetyl-L-cysteine (CHEBI:28939) |
| N-acetyl-L-cysteinyl residue (CHEBI:133372) is substituent group from N-acetyl-L-cysteine (CHEBI:28939) |
| IUPAC Name |
|---|
| N-acetyl-L-cysteine |
| INNs | Source |
|---|---|
| acetilcisteina | ChemIDplus |
| acetylcysteinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2R)-2-acetylamino-3-sulfanylpropanoic acid | IUPAC |
| Acetylcysteine | KEGG COMPOUND |
| N-acetylcysteine | ChemIDplus |
| N-acetyl-L-(+)-cysteine | NIST Chemistry WebBook |
| (R)-mercapturic acid | ChemIDplus |
| mercapturic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 66 | DrugCentral |
| Acetylcysteine | Wikipedia |
| C06809 | KEGG COMPOUND |
| CPD-9175 | MetaCyc |
| D00221 | KEGG DRUG |
| DB06151 | DrugBank |
| HMDB0001890 | HMDB |
| LSM-4672 | LINCS |
| SC2 | PDBeChem |
| Citations |
|---|