EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H29NO |
| Net Charge | 0 |
| Average Mass | 275.436 |
| Monoisotopic Mass | 275.22491 |
| SMILES | CCCCCCC[C@@H]1C[C@H](O)[C@H](Cc2ccccc2)N1 |
| InChI | InChI=1S/C18H29NO/c1-2-3-4-5-9-12-16-14-18(20)17(19-16)13-15-10-7-6-8-11-15/h6-8,10-11,16-20H,2-5,9,12-14H2,1H3/t16-,17+,18+/m1/s1 |
| InChIKey | ZWOWUVBTGMGXFA-SQNIBIBYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (30078607) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asperidine A (CHEBI:215474) is a aralkylamine (CHEBI:18000) |
| IUPAC Name |
|---|
| (2S,3S,5R)-2-benzyl-5-heptylpyrrolidin-3-ol |