EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H48N6O6 |
| Net Charge | 0 |
| Average Mass | 600.761 |
| Monoisotopic Mass | 600.36353 |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C31H48N6O6/c1-8-19(6)26-31(43)33-20(7)27(39)35-23(15-21-12-10-9-11-13-21)28(40)32-16-24(38)34-22(14-17(2)3)29(41)36-25(18(4)5)30(42)37-26/h9-13,17-20,22-23,25-26H,8,14-16H2,1-7H3,(H,32,40)(H,33,43)(H,34,38)(H,35,39)(H,36,41)(H,37,42)/t19-,20+,22-,23+,25-,26-/m0/s1 |
| InChIKey | OBFRQFUQLPRNNO-WLBISBHISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus (ncbitaxon:1386) | - | PubMed (29422389) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bacicyclin (CHEBI:215462) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (3R,6R,9S,12S,15S)-3-benzyl-9-[(2S)-butan-2-yl]-6-methyl-15-(2-methylpropyl)-12-propan-2-yl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |