EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O5 |
| Net Charge | 0 |
| Average Mass | 338.359 |
| Monoisotopic Mass | 338.11542 |
| SMILES | O=C1C[C@@H]2[C@H]3CC[C@H](O)c4c(O)ccc(c43)[C@]2(O)c2cccc(O)c21 |
| InChI | InChI=1S/C20H18O5/c21-13-3-1-2-10-18(13)16(24)8-12-9-4-6-14(22)19-15(23)7-5-11(17(9)19)20(10,12)25/h1-3,5,7,9,12,14,21-23,25H,4,6,8H2/t9-,12-,14+,20-/m1/s1 |
| InChIKey | JANZOCFCNANROF-CNVPDMNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daldinia eschscholzii IFB-TL01 (ncbitaxon:1169046) | - | PubMed (26363879) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Daldinone F (CHEBI:215456) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| (2S,11R,12R,15S)-2,7,15,17-tetrahydroxypentacyclo[10.7.1.02,11.03,8.016,20]icosa-1(20),3(8),4,6,16,18-hexaen-9-one |
| Manual Xrefs | Databases |
|---|---|
| 78441531 | ChemSpider |