EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O3 |
| Net Charge | 0 |
| Average Mass | 402.534 |
| Monoisotopic Mass | 402.21949 |
| SMILES | CC(=O)/C(C)=C/C=C/C=C\C=C\C=C\C=C/C=C/C=C\C=C\C=C\C/C=C/C(=O)O |
| InChI | InChI=1S/C27H30O3/c1-25(26(2)28)23-21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-24-27(29)30/h3-19,21-24H,20H2,1-2H3,(H,29,30)/b5-3-,6-4+,9-7+,10-8-,13-11+,14-12+,17-15-,18-16+,21-19+,24-22+,25-23+ |
| InChIKey | ZUWHINCAQDXMJU-CENJIFQDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Laetiporus sulphureus (ncbitaxon:5630) | - | PubMed (15797608) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Dehydro-3-deoxylaetiporic acid A (CHEBI:215440) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (2E,5E,7E,9Z,11E,13Z,15E,17E,19Z,21E,23E)-24-methyl-25-oxohexacosa-2,5,7,9,11,13,15,17,19,21,23-undecaenoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9479178 | ChemSpider |