EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H56N6O13 |
| Net Charge | 0 |
| Average Mass | 744.840 |
| Monoisotopic Mass | 744.39054 |
| SMILES | C/C(=C/C(=O)N(O)CCC[C@H](NC(=O)[C@H](CCCN(O)C(=O)/C=C(/C)CCO)NC(=O)[C@@H](N)CCCN(O)C(=O)/C=C(/C)CCO)C(=O)O)CCO |
| InChI | InChI=1S/C33H56N6O13/c1-22(10-16-40)19-28(43)37(50)13-4-7-25(34)31(46)35-26(8-5-14-38(51)29(44)20-23(2)11-17-41)32(47)36-27(33(48)49)9-6-15-39(52)30(45)21-24(3)12-18-42/h19-21,25-27,40-42,50-52H,4-18,34H2,1-3H3,(H,35,46)(H,36,47)(H,48,49)/b22-19-,23-20-,24-21-/t25-,26-,27-/m0/s1 |
| InChIKey | CZNDRNTWCVIHIP-VOUIFILWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | DOI (10.1021/jo00350a043) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Des(diserylglycyl)ferrirhodin (CHEBI:215400) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-[[(2S)-2-amino-5-[hydroxy-[(Z)-5-hydroxy-3-methylpent-2-enoyl]amino]pentanoyl]amino]-5-[hydroxy-[(Z)-5-hydroxy-3-methylpent-2-enoyl]amino]pentanoyl]amino]-5-[hydroxy-[(Z)-5-hydroxy-3-methylpent-2-enoyl]amino]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442642 | ChemSpider |