EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O |
| Net Charge | 0 |
| Average Mass | 212.292 |
| Monoisotopic Mass | 212.12012 |
| SMILES | C[C@]12CCCCC1=CC=C1C(=O)C=CC=C12 |
| InChI | InChI=1S/C15H16O/c1-15-10-3-2-5-11(15)8-9-12-13(15)6-4-7-14(12)16/h4,6-9H,2-3,5,10H2,1H3/t15-/m0/s1 |
| InChIKey | AHCCSFZXRLQQHD-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stutzerimonas stutzeri (ncbitaxon:316) | - | PubMed (18093138) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Zafrin (CHEBI:215392) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (4bS)-4b-methyl-5,6,7,8-tetrahydrophenanthren-1-one |
| Manual Xrefs | Databases |
|---|---|
| 78440380 | ChemSpider |