EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O6 |
| Net Charge | 0 |
| Average Mass | 240.211 |
| Monoisotopic Mass | 240.06339 |
| SMILES | CO[C@@]1([C@@H](C)O)OC(=O)c2ccc(O)c(O)c21 |
| InChI | InChI=1S/C11H12O6/c1-5(12)11(16-2)8-6(10(15)17-11)3-4-7(13)9(8)14/h3-5,12-14H,1-2H3/t5-,11+/m1/s1 |
| InChIKey | NNWSAMVVKGKOKM-GCXOYZPQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dictyosporium digitatum (ncbitaxon:328853) | - | PubMed (32078832) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dictyophthalide A (CHEBI:215377) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3R)-4,5-dihydroxy-3-[(1R)-1-hydroxyethyl]-3-methoxy-2-benzouran-1-one |