EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40O7 |
| Net Charge | 0 |
| Average Mass | 500.632 |
| Monoisotopic Mass | 500.27740 |
| SMILES | CC[C@]12CC[C@](C)(O1)[C@H]1CC[C@@]3(C)C4=C(C(=O)C[C@]13CO2)[C@@](C)(CCC(=O)O)[C@H](C1(C)CO1)CC4=O |
| InChI | InChI=1S/C29H40O7/c1-6-29-12-11-26(4,36-29)19-7-10-25(3)23-17(30)13-20(27(5)15-34-27)24(2,9-8-21(32)33)22(23)18(31)14-28(19,25)16-35-29/h19-20H,6-16H2,1-5H3,(H,32,33)/t19-,20-,24+,25+,26+,27?,28+,29-/m1/s1 |
| InChIKey | JYNAFHGXISHKLU-LAGIPVKXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma orbiforme (ncbitaxon:1236583) | - | DOI (10.1016/j.phytol.2018.09.017) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ganoboninketal F (CHEBI:215360) is a carbocyclic fatty acid (CHEBI:35744) |
| IUPAC Name |
|---|
| 3-[(1S,2S,5R,9R,10S,14S,17R)-17-ethyl-1,5,10-trimethyl-9-(2-methyloxiran-2-yl)-7,12-dioxo-16,20-dioxapentacyclo[15.2.1.02,14.05,14.06,11]icos-6(11)-en-10-yl]propanoic acid |