EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14N2O4 |
| Net Charge | 0 |
| Average Mass | 286.287 |
| Monoisotopic Mass | 286.09536 |
| SMILES | COC(=O)c1cc2c(nc3ccc(O)cc32)c([C@H](C)O)n1 |
| InChI | InChI=1S/C15H14N2O4/c1-7(18)13-14-10(6-12(17-13)15(20)21-2)9-5-8(19)3-4-11(9)16-14/h3-7,16,18-19H,1-2H3/t7-/m0/s1 |
| InChIKey | ISXKMLWFKQPKAB-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ophiocordyceps (ncbitaxon:474995) | - | DOI (10.1016/j.phytol.2018.07.020) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sphecoline B (CHEBI:215296) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| methyl 6-hydroxy-1-[(1S)-1-hydroxyethyl]-9H-pyrido[3,4-b]indole-3-carboxylate |