EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19N3O5 |
| Net Charge | 0 |
| Average Mass | 381.388 |
| Monoisotopic Mass | 381.13247 |
| SMILES | O=C(O)c1cc2c(nc3ccccc32)c(CCC(=O)N2CCC[C@H]2C(=O)O)n1 |
| InChI | InChI=1S/C20H19N3O5/c24-17(23-9-3-6-16(23)20(27)28)8-7-14-18-12(10-15(21-14)19(25)26)11-4-1-2-5-13(11)22-18/h1-2,4-5,10,16,22H,3,6-9H2,(H,25,26)(H,27,28)/t16-/m0/s1 |
| InChIKey | VSQKKTIEHWELDM-INIZCTEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycena metata (ncbitaxon:1033252) | - | PubMed (23330951) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Metatacarboline A (CHEBI:215285) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| 1-[3-[(2S)-2-carboxypyrrolidin-1-yl]-3-oxopropyl]-9H-pyrido[3,4-b]indole-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 58917832 | ChemSpider |