EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H44N10O13 |
| Net Charge | 0 |
| Average Mass | 776.761 |
| Monoisotopic Mass | 776.30893 |
| SMILES | NC(N)=NCCC[C@@H](NC(=O)c1cccc(O)c1O)C(=O)N[C@@H](COC(=O)[C@H](CO)NC(=O)[C@@H](CCCN=C(N)N)NC(=O)c1cccc(O)c1O)C(=O)O |
| InChI | InChI=1S/C32H44N10O13/c33-31(34)37-11-3-7-17(39-25(48)15-5-1-9-21(44)23(15)46)27(50)41-19(13-43)30(54)55-14-20(29(52)53)42-28(51)18(8-4-12-38-32(35)36)40-26(49)16-6-2-10-22(45)24(16)47/h1-2,5-6,9-10,17-20,43-47H,3-4,7-8,11-14H2,(H,39,48)(H,40,49)(H,41,50)(H,42,51)(H,52,53)(H4,33,34,37)(H4,35,36,38)/t17-,18-,19+,20+/m1/s1 |
| InChIKey | YEDLPYZUUMOKKH-ZRNYENFQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vibrio campbellii DS40M4 (ncbitaxon:1088888) | - | PubMed (20521785) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Divanchrobactin (CHEBI:215275) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-2-[[(2R)-5-(diaminomethylideneamino)-2-[(2,3-dihydroxybenzoyl)amino]pentanoyl]amino]-3-[(2S)-2-[[(2R)-5-(diaminomethylideneamino)-2-[(2,3-dihydroxybenzoyl)amino]pentanoyl]amino]-3-hydroxypropanoyl]oxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 25032431 | ChemSpider |