EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28Cl2O6 |
| Net Charge | 0 |
| Average Mass | 495.399 |
| Monoisotopic Mass | 494.12629 |
| SMILES | C=C(C)C(=O)CCC(C)=CC[C@@]12OC(C)(C)[C@H](Cl)C[C@]1(Cl)C(=O)c1c(O)cc(O)cc1C2=O |
| InChI | InChI=1S/C25H28Cl2O6/c1-13(2)17(29)7-6-14(3)8-9-25-21(31)16-10-15(28)11-18(30)20(16)22(32)24(25,27)12-19(26)23(4,5)33-25/h8,10-11,19,28,30H,1,6-7,9,12H2,2-5H3/t19-,24+,25+/m1/s1 |
| InChIKey | YAMAETJPGJWVHQ-NGXZDTIWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (18271555) |
| Roles Classification |
|---|
| Biological Roles: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-oxonapyradiomycin A2 (CHEBI:215272) is a vitamin K (CHEBI:28384) |
| IUPAC Name |
|---|
| (3R,4aR,10aS)-3,4a-dichloro-10a-(3,7-dimethyl-6-oxoocta-2,7-dienyl)-6,8-dihydroxy-2,2-dimethyl-3,4-dihydrobenzo[g]chromene-5,10-dione |
| Manual Xrefs | Databases |
|---|---|
| 78437536 | ChemSpider |