EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N4O8S2 |
| Net Charge | 0 |
| Average Mass | 510.550 |
| Monoisotopic Mass | 510.08791 |
| SMILES | C[C@@](CSSC[C@](C)(NC(=O)c1ncccc1O)C(=O)O)(NC(=O)c1ncccc1O)C(=O)O |
| InChI | InChI=1S/C20H22N4O8S2/c1-19(17(29)30,23-15(27)13-11(25)5-3-7-21-13)9-33-34-10-20(2,18(31)32)24-16(28)14-12(26)6-4-8-22-14/h3-8,25-26H,9-10H2,1-2H3,(H,23,27)(H,24,28)(H,29,30)(H,31,32)/t19-,20-/m0/s1 |
| InChIKey | ZCTPMLZHDHDIAO-PMACEKPBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (31986449) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Streptomethiocin B (CHEBI:215268) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2R)-3-[[(2R)-2-carboxy-2-[(3-hydroxypyridine-2-carbonyl)amino]propyl]disulanyl]-2-[(3-hydroxypyridine-2-carbonyl)amino]-2-methylpropanoic acid |