EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15N3O6S |
| Net Charge | 0 |
| Average Mass | 377.378 |
| Monoisotopic Mass | 377.06816 |
| SMILES | C[C@@](CSC(=O)c1ncccc1O)(NC(=O)c1ncccc1O)C(=O)O |
| InChI | InChI=1S/C16H15N3O6S/c1-16(15(24)25,19-13(22)11-9(20)4-2-6-17-11)8-26-14(23)12-10(21)5-3-7-18-12/h2-7,20-21H,8H2,1H3,(H,19,22)(H,24,25)/t16-/m0/s1 |
| InChIKey | WINFBQDJWDNOPW-INIZCTEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (31986449) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Streptomethiocin A (CHEBI:215263) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2R)-2-[(3-hydroxypyridine-2-carbonyl)amino]-3-(3-hydroxypyridine-2-carbonyl)sulanyl-2-methylpropanoic acid |