EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14O4 |
| Net Charge | 0 |
| Average Mass | 186.207 |
| Monoisotopic Mass | 186.08921 |
| SMILES | C=C(C)[C@H](CCC(=O)OC)C(=O)O |
| InChI | InChI=1S/C9H14O4/c1-6(2)7(9(11)12)4-5-8(10)13-3/h7H,1,4-5H2,2-3H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | KIINVCJXLPORTK-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acremoniumspecies (ncbitaxon:2046025) | - | PubMed (12444684) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pentanedioic acid 2-(1-methylethenyl)-5-methyl ester (CHEBI:215248) is a methyl-branched fatty acid (CHEBI:62499) |
| IUPAC Name |
|---|
| 5-methoxy-5-oxo-2-prop-1-en-2-ylpentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9107385 | ChemSpider |