EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29N2O5S |
| Net Charge | +1 |
| Average Mass | 433.550 |
| Monoisotopic Mass | 433.17917 |
| SMILES | CC(=O)N[C@@H](CSc1ccc[n+]2c1[C@](C)(O)[C@@H](O)[C@@H]2/C=C(C)/C=C/C1CC1)C(=O)O |
| InChI | InChI=1S/C22H28N2O5S/c1-13(6-7-15-8-9-15)11-17-20(26)22(3,29)19-18(5-4-10-24(17)19)30-12-16(21(27)28)23-14(2)25/h4-7,10-11,15-17,20,26,29H,8-9,12H2,1-3H3,(H-,23,25,27,28)/p+1/b7-6+,13-11+/t16-,17-,20-,22-/m0/s1 |
| InChIKey | RILBGEGSZCNKQV-NXLPWASNSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies HZP-2216E (ncbitaxon:1742702) | - | PubMed (28923323) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Streptopertusacin A (CHEBI:215244) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2R)-2-acetamido-3-[[(1S,2S,3S)-3-[(1E,3E)-4-cyclopropyl-2-methylbuta-1,3-dienyl]-1,2-dihydroxy-1-methyl-2,3-dihydroindolizin-4-ium-8-yl]sulanyl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78443816 | ChemSpider |