EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:215236 - 2,2',7,7'-Tetrachlorohypericin
| Formula | C30H12Cl4O8 |
| Net Charge | 0 |
| Average Mass | 642.230 |
| Monoisotopic Mass | 639.92863 |
| SMILES | Cc1c(Cl)c(=O)c2c(O)c3c(O)c(Cl)c(O)c4c5c(O)c(Cl)c(O)c6c(=O)c7c(O)c(Cl)c(C)c8c1c2c(c34)c(c65)c78 |
| InChI | InChI=1S/C30H12Cl4O8/c1-3-5-6-4(2)20(32)28(40)16-8(6)10-9-7(5)15(27(39)19(3)31)23(35)17-11(9)13(25(37)21(33)29(17)41)14-12(10)18(24(16)36)30(42)22(34)26(14)38/h35,37-38,40-42H,1-2H3 |
| InChIKey | NBVIPXNCVNJJQP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nephroma laevigatum (ncbitaxon:203386) | - | DOI (10.1021/np50118a006) |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,2',7,7'-Tetrachlorohypericin (CHEBI:215236) is a ortho- and peri-fused polycyclic arene (CHEBI:35300) |