EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H24N4O3 |
| Net Charge | 0 |
| Average Mass | 260.338 |
| Monoisotopic Mass | 260.18484 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](O)C[C@H](N)CN)C(N)=O |
| InChI | InChI=1S/C11H24N4O3/c1-6(2)3-8(10(14)17)15-11(18)9(16)4-7(13)5-12/h6-9,16H,3-5,12-13H2,1-2H3,(H2,14,17)(H,15,18)/t7-,8-,9-/m0/s1 |
| InChIKey | VTJRQLJOIUWHBZ-CIUDSAMLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies TC1 (ncbitaxon:1340895) | - | PubMed (24387661) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-[[(2S,4S)-4,5-diamino-2-hydroxypentanoyl]amino]-4-methylpentanamide (CHEBI:215174) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S,4S)-4,5-diamino-2-hydroxypentanoyl]amino]-4-methylpentanamide |
| Manual Xrefs | Databases |
|---|---|
| 31128889 | ChemSpider |