EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O5 |
| Net Charge | 0 |
| Average Mass | 490.725 |
| Monoisotopic Mass | 490.36582 |
| SMILES | C/C(=C\CC[C@@H](C)[C@H]1C[C@@](C)(O)C2=C3[C@H](O)C[C@H]4C(C)(C)[C@@H](O)CC[C@]4(C)[C@@]3(O)CC[C@@]21C)CO |
| InChI | InChI=1S/C30H50O5/c1-18(17-31)9-8-10-19(2)20-16-29(7,34)25-24-21(32)15-22-26(3,4)23(33)11-12-28(22,6)30(24,35)14-13-27(20,25)5/h9,19-23,31-35H,8,10-17H2,1-7H3/b18-9+/t19-,20-,21-,22+,23+,27-,28+,29-,30-/m1/s1 |
| InChIKey | GQTPJOWTKSDIOQ-RYENBMNQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma casuarinicola (ncbitaxon:2057914) | - | PubMed (31855780) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ganocasuarin B (CHEBI:215170) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (3S,5S,7R,9S,10S,13R,15R,17R)-17-[(E,2R)-7-hydroxy-6-methylhept-5-en-2-yl]-4,4,10,13,15-pentamethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthrene-3,7,9,15-tetrol |
| Manual Xrefs | Databases |
|---|---|
| 113385758 | ChemSpider |