EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36O7 |
| Net Charge | 0 |
| Average Mass | 460.567 |
| Monoisotopic Mass | 460.24610 |
| SMILES | CC1=CC[C@@H]2[C@@H](C1)[C@@H]1O[C@]1(C)[C@H]1[C@]3(C)OCC[C@@H](C)[C@H]3O[C@H](/C=C/C=C/C(=O)O)[C@@H](O)[C@]12O |
| InChI | InChI=1S/C26H36O7/c1-14-9-10-17-16(13-14)22-25(4,33-22)23-24(3)21(15(2)11-12-31-24)32-18(20(29)26(17,23)30)7-5-6-8-19(27)28/h5-9,15-18,20-23,29-30H,10-13H2,1-4H3,(H,27,28)/b7-5+,8-6+/t15-,16-,17-,18-,20-,21-,22+,23-,24-,25+,26+/m1/s1 |
| InChIKey | IMBCJIVTDCKBCY-JYNMXDDLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pyrenulaspecies (ncbitaxon:2530106) | - | DOI (10.1016/j.phytol.2018.05.020) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyrenulic acid I (CHEBI:215165) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E)-5-[(1R,2R,4S,5R,10R,11R,12R,13R,15R,16R,20S)-11,12-dihydroxy-2,7,16,20-tetramethyl-3,14,19-trioxapentacyclo[9.9.0.02,4.05,10.015,20]icos-7-en-13-yl]penta-2,4-dienoic acid |