EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N2O3 |
| Net Charge | 0 |
| Average Mass | 250.298 |
| Monoisotopic Mass | 250.13174 |
| SMILES | CCCCc1ccc(C(=O)NCC(=O)OC)nc1 |
| InChI | InChI=1S/C13H18N2O3/c1-3-4-5-10-6-7-11(14-8-10)13(17)15-9-12(16)18-2/h6-8H,3-5,9H2,1-2H3,(H,15,17) |
| InChIKey | UFGOYDVOCQNQRP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Climacocystis montana (ncbitaxon:1519435) | - | DOI (10.1016/j.phytol.2018.05.019) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Climacomontaninate B (CHEBI:215160) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| methyl 2-[(5-butylpyridine-2-carbonyl)amino]acetate |