EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H44O8 |
| Net Charge | 0 |
| Average Mass | 556.696 |
| Monoisotopic Mass | 556.30362 |
| SMILES | CC(=O)O[C@H]1C[C@H]2C(C)(C)C(=O)CC[C@]2(C)C2=C1[C@]1(C)[C@@H](O)C[C@@]3(O[C@]4(C[C@H]3C)C[C@H](C)C(=O)O4)[C@@]1(C)CC2=O |
| InChI | InChI=1S/C32H44O8/c1-16-12-31(39-26(16)37)13-17(2)32(40-31)15-23(36)30(8)25-20(38-18(3)33)11-21-27(4,5)22(35)9-10-28(21,6)24(25)19(34)14-29(30,32)7/h16-17,20-21,23,36H,9-15H2,1-8H3/t16-,17+,20-,21-,23-,28-,29-,30-,31-,32-/m0/s1 |
| InChIKey | PNSDYTZVWBPCNV-BMHSORMDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma calidophilum (ncbitaxon:2026244) | - | PubMed (28800421) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Spiroganocalitone D (CHEBI:215158) is a withanolide (CHEBI:74716) |
| Manual Xrefs | Databases |
|---|---|
| 78442369 | ChemSpider |