EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:215154 - Spiroganocalitone C
| Formula | C32H44O7 |
| Net Charge | 0 |
| Average Mass | 540.697 |
| Monoisotopic Mass | 540.30870 |
| SMILES | CC(=O)O[C@H]1C[C@@]2(O[C@]3(C[C@H]2C)C[C@H](C)C(=O)O3)[C@@]2(C)CC(=O)C3=C(CC[C@H]4C(C)(C)C(=O)CC[C@]34C)[C@]12C |
| InChI | InChI=1S/C32H44O7/c1-17-13-31(38-26(17)36)14-18(2)32(39-31)16-24(37-19(3)33)30(8)20-9-10-22-27(4,5)23(35)11-12-28(22,6)25(20)21(34)15-29(30,32)7/h17-18,22,24H,9-16H2,1-8H3/t17-,18+,22-,24-,28-,29-,30+,31-,32-/m0/s1 |
| InChIKey | CBIUBTXMBZHHAC-DOIHQTOASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma calidophilum (ncbitaxon:2026244) | - | PubMed (28800421) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Spiroganocalitone C (CHEBI:215154) is a withanolide (CHEBI:74716) |
| Manual Xrefs | Databases |
|---|---|
| 78442368 | ChemSpider |