EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N2O3 |
| Net Charge | 0 |
| Average Mass | 264.325 |
| Monoisotopic Mass | 264.14739 |
| SMILES | CCCCc1ccc(C(=O)N[C@H](C)C(=O)OC)nc1 |
| InChI | InChI=1S/C14H20N2O3/c1-4-5-6-11-7-8-12(15-9-11)13(17)16-10(2)14(18)19-3/h7-10H,4-6H2,1-3H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | PZVBDKSIQJHTRT-SNVBAGLBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Climacocystis montana (ncbitaxon:1519435) | - | DOI (10.1016/j.phytol.2018.05.019) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Climacomontaninate A (CHEBI:215153) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| methyl (2R)-2-[(5-butylpyridine-2-carbonyl)amino]propanoate |