EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:215147 - Spiroganocalitone A
| Formula | C30H42O6 |
| Net Charge | 0 |
| Average Mass | 498.660 |
| Monoisotopic Mass | 498.29814 |
| SMILES | C[C@@H]1C[C@]2(C[C@H](C)C(=O)O2)O[C@@]12C[C@H](O)[C@@]1(C)C3=C(C(=O)C[C@]21C)[C@@]1(C)CCC(=O)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C30H42O6/c1-16-12-29(35-24(16)34)13-17(2)30(36-29)15-22(33)28(7)18-8-9-20-25(3,4)21(32)10-11-26(20,5)23(18)19(31)14-27(28,30)6/h16-17,20,22,33H,8-15H2,1-7H3/t16-,17+,20-,22-,26-,27-,28+,29-,30-/m0/s1 |
| InChIKey | FQVBBEDMAXTBIY-RHXNVEANSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma calidophilum (ncbitaxon:2026244) | - | PubMed (28800421) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Spiroganocalitone A (CHEBI:215147) is a withanolide (CHEBI:74716) |
| Manual Xrefs | Databases |
|---|---|
| 78442366 | ChemSpider |