EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H24O11 |
| Net Charge | 0 |
| Average Mass | 560.511 |
| Monoisotopic Mass | 560.13186 |
| SMILES | C[C@@H]1c2c(O)cc(O)c3c2[C@H]2[C@H](CC(=O)C4=C(O)c5c(O)cc(O)cc5[C@@H](C3=O)[C@]42Cc2cc(O)cc(=O)o2)[C@H]1O |
| InChI | InChI=1S/C30H24O11/c1-9-20-16(34)7-17(35)22-23(20)24-14(27(9)38)6-18(36)26-28(39)21-13(3-11(32)4-15(21)33)25(29(22)40)30(24,26)8-12-2-10(31)5-19(37)41-12/h2-5,7,9,14,24-25,27,31-35,38-39H,6,8H2,1H3/t9-,14+,24-,25+,27+,30-/m1/s1 |
| InChIKey | WAZKTFRGYZXOEK-MHIUQONVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (16061376) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| A-74528 (CHEBI:215125) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (1R,12S,13R,14R,21S,22R)-4,6,8,13,16,18-hexahydroxy-22-[(4-hydroxy-6-oxopyran-2-yl)methyl]-14-methylhexacyclo[17.3.1.02,7.09,22.012,21.015,20]tricosa-2(7),3,5,8,15(20),16,18-heptaene-10,23-dione |
| Manual Xrefs | Databases |
|---|---|
| 23263172 | ChemSpider |