EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H59N3O9 |
| Net Charge | 0 |
| Average Mass | 653.858 |
| Monoisotopic Mass | 653.42513 |
| SMILES | CC[C@H](C)[C@H]1OC(=O)[C@H](C(C)C)N(C)C(=O)[C@@H](C(C)C)OC(=O)[C@H](C(C)C)N(C)C(=O)[C@@H](C(C)C)OC(=O)[C@H](C(C)C)N(C)C1=O |
| InChI | InChI=1S/C34H59N3O9/c1-16-22(12)28-31(40)37(15)24(18(4)5)33(42)45-26(20(8)9)29(38)35(13)23(17(2)3)32(41)44-27(21(10)11)30(39)36(14)25(19(6)7)34(43)46-28/h17-28H,16H2,1-15H3/t22-,23-,24-,25-,26+,27+,28+/m0/s1 |
| InChIKey | GLJAZFODNQNIGM-UMURLBKASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| [Torrubiella hemipterigena (ncbitaxon:1531966) | - | DOI (10.1016/s0040-4020(02)01631-9) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Enniatin H (CHEBI:215099) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3S,6R,9S,12R,15S,18R)-6-[(2S)-butan-2-yl]-4,10,16-trimethyl-3,9,12,15,18-penta(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |
| Manual Xrefs | Databases |
|---|---|
| 9279395 | ChemSpider |