EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H35NO6 |
| Net Charge | 0 |
| Average Mass | 445.556 |
| Monoisotopic Mass | 445.24644 |
| SMILES | CC(C)C(O)(CC1C(=O)C(=C(O)/C=C/[C@@H]2[C@H]3CCCC[C@@H]3C=C[C@@H]2C)C(=O)N1C)C(=O)O |
| InChI | InChI=1S/C25H35NO6/c1-14(2)25(32,24(30)31)13-19-22(28)21(23(29)26(19)4)20(27)12-11-17-15(3)9-10-16-7-5-6-8-18(16)17/h9-12,14-19,27,32H,5-8,13H2,1-4H3,(H,30,31)/b12-11+,21-20?/t15-,16+,17-,18-,19?,25?/m0/s1 |
| InChIKey | HYGFSUQJOBSOGP-YBIQCROSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zopfiella (ncbitaxon:252180) | - | DOI (10.1016/s0040-4020(02)00942-0) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Zopfiellamide A (CHEBI:215063) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 2-[[4-[(E)-3-[(1S,2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-1-hydroxyprop-2-enylidene]-1-methyl-3,5-dioxopyrrolidin-2-yl]methyl]-2-hydroxy-3-methylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78437530 | ChemSpider |