EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15N3O4S2 |
| Net Charge | 0 |
| Average Mass | 365.436 |
| Monoisotopic Mass | 365.05040 |
| SMILES | COc1cccc2nc3sc(SC[C@H](NC(C)=O)C(=O)O)nc3c12 |
| InChI | InChI=1S/C15H15N3O4S2/c1-7(19)16-9(14(20)21)6-23-15-18-12-11-8(17-13(12)24-15)4-3-5-10(11)22-2/h3-5,9,17H,6H2,1-2H3,(H,16,19)(H,20,21)/t9-/m0/s1 |
| InChIKey | CCYURQHTZWFINX-VIFPVBQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Colletotrichum (ncbitaxon:5455) | - | PubMed (31683228) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-S-(8-methoxy-4H-thiazolo[5,4-b]indol-2-yl)-L-cysteine (CHEBI:215004) is a N-acyl-L-amino acid (CHEBI:21644) |
| IUPAC Name |
|---|
| (2R)-2-acetamido-3-[(8-methoxy-4H-[1,3]thiazolo[5,4-b]indol-2-yl)sulanyl]propanoic acid |