EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O5 |
| Net Charge | 0 |
| Average Mass | 320.385 |
| Monoisotopic Mass | 320.16237 |
| SMILES | CC(CCC(=O)O)C1=CC[C@@]2(C)OC3=C(C[C@@H]12)C(=O)CC[C@@H]3O |
| InChI | InChI=1S/C18H24O5/c1-10(3-6-16(21)22)11-7-8-18(2)13(11)9-12-14(19)4-5-15(20)17(12)23-18/h7,10,13,15,20H,3-6,8-9H2,1-2H3,(H,21,22)/t10?,13-,15-,18+/m0/s1 |
| InChIKey | WJQWOEGUVPIDSQ-GFQZTYJBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria (ncbitaxon:5598) | - | DOI (10.1016/j.phytol.2017.12.009) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tricycloalternarene L (CHEBI:215002) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 4-[(3aR,5S,9aS)-5-hydroxy-3a-methyl-8-oxo-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-1-yl]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 65328931 | ChemSpider |