EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O2 |
| Net Charge | 0 |
| Average Mass | 290.447 |
| Monoisotopic Mass | 290.22458 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@@H](O)CC[C@@]34[H])[C@@]1(C)CCC(=O)C2 |
| InChI | InChI=1S/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12,14-17,21H,3-11H2,1-2H3/t12-,14+,15+,16+,17+,18+,19+/m1/s1 |
| InChIKey | NVKAWKQGWWIWPM-MISPCMORSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5β-dihydrotestosterone (CHEBI:2150) has role androgen (CHEBI:50113) |
| 5β-dihydrotestosterone (CHEBI:2150) has role human metabolite (CHEBI:77746) |
| 5β-dihydrotestosterone (CHEBI:2150) has role mouse metabolite (CHEBI:75771) |
| 5β-dihydrotestosterone (CHEBI:2150) has role vasodilator agent (CHEBI:35620) |
| 5β-dihydrotestosterone (CHEBI:2150) is a 17β-hydroxyandrostan-3-one (CHEBI:85278) |
| 5β-dihydrotestosterone (CHEBI:2150) is a 3-oxo-5β-steroid (CHEBI:1624) |
| IUPAC Name |
|---|
| 17β-hydroxy-5βandrostan-3-one |
| Synonyms | Source |
|---|---|
| (5β,17β)-17-hydroxyandrostan-3-one | IUPAC |
| (5β,8α,17β)-17-hydroxyandrostan-3-one | PDBeChem |
| 5β-androstan-17β-ol-3-one | ChemIDplus |
| etiocholan-17-beta-ol-3-one | ChemIDplus |
| 5β,17β-hydroxyandrostan-3-one | ChemIDplus |
| 5-beta-DHT | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 5β-dihydrotestosterone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C05293 | KEGG COMPOUND |
| BDT | PDBeChem |
| LMST02020069 | LIPID MAPS |
| HMDB0006770 | HMDB |
| DB07447 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2334616 | Reaxys |
| CAS:571-22-2 | KEGG COMPOUND |
| CAS:571-22-2 | ChemIDplus |
| Citations |
|---|