EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H15NO3 |
| Net Charge | 0 |
| Average Mass | 233.267 |
| Monoisotopic Mass | 233.10519 |
| SMILES | C=CC(C)(C)C(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C13H15NO3/c1-4-13(2,3)12(17)14-10-8-6-5-7-9(10)11(15)16/h4-8H,1H2,2-3H3,(H,14,17)(H,15,16) |
| InChIKey | HYTASTDPBZOUKV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eurotium (ncbitaxon:28569) | - | PubMed (28586721) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[(2,2-dimethylbut-3-enoyl)amino]benzoic acid (CHEBI:214938) is a benzoic acids (CHEBI:22723) |
| IUPAC Name |
|---|
| 2-(2,2-dimethylbut-3-enoylamino)benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 63002622 | ChemSpider |