EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29NO5 |
| Net Charge | 0 |
| Average Mass | 387.476 |
| Monoisotopic Mass | 387.20457 |
| SMILES | C/C=C(C)/C=C/C(=O)N[C@H](C(=O)O[C@H](C)[C@@H](C)C(=O)O)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C22H29NO5/c1-6-14(2)12-13-19(24)23-20(16(4)18-10-8-7-9-11-18)22(27)28-17(5)15(3)21(25)26/h6-13,15-17,20H,1-5H3,(H,23,24)(H,25,26)/b13-12+,14-6+/t15-,16-,17-,20+/m1/s1 |
| InChIKey | VVPVXDHEFAYPAR-ZZSCLJTRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (30065171) | |
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (22583058) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Jomthonic acid A (CHEBI:214930) is a depsipeptide (CHEBI:23643) |
| IUPAC Names |
|---|
| 2-methyl-3-[2-[[(2E,4E)-4-methylhexa-2,4-dienoyl]amino]-3-phenylbutanoyl]oxybutanoic acid |
| (2R,3R)-2-methyl-3-[(2S,3R)-2-[[(2E,4E)-4-methylhexa-2,4-dienoyl]amino]-3-phenylbutanoyl]oxybutanoic acid |