EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O5 |
| Net Charge | 0 |
| Average Mass | 210.185 |
| Monoisotopic Mass | 210.05282 |
| SMILES | CC(=O)Cc1cc(O)cc(O)c1C(=O)O |
| InChI | InChI=1S/C10H10O5/c1-5(11)2-6-3-7(12)4-8(13)9(6)10(14)15/h3-4,12-13H,2H2,1H3,(H,14,15) |
| InChIKey | SIXWWNJBOOYCOG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium brevicompactum (ncbitaxon:5074) | - | DOI (10.1007/bf00572701) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dihydroxy-6-(2-oxopropyl)-benzoic acid (CHEBI:214912) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 2,4-dihydroxy-6-(2-oxopropyl)benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 133000 | ChemSpider |