EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O6 |
| Net Charge | 0 |
| Average Mass | 348.395 |
| Monoisotopic Mass | 348.15729 |
| SMILES | CCCCC/C=C/C1=C(CO)C(=O)[C@H]2O[C@@]2(C/C=C(\C)C(=O)O)C1=O |
| InChI | InChI=1S/C19H24O6/c1-3-4-5-6-7-8-13-14(11-20)15(21)17-19(25-17,16(13)22)10-9-12(2)18(23)24/h7-9,17,20H,3-6,10-11H2,1-2H3,(H,23,24)/b8-7+,12-9+/t17-,19+/m1/s1 |
| InChIKey | UJNVMSXVUCFBMB-SLHMXGKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pestalotiopsis (ncbitaxon:37840) | - | PubMed (28463686) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pestalic acid E (CHEBI:214910) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| (E)-4-[(1R,6S)-3-[(E)-hept-1-enyl]-4-(hydroxymethyl)-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-1-yl]-2-methylbut-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442160 | ChemSpider |