EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O6 |
| Net Charge | 0 |
| Average Mass | 338.400 |
| Monoisotopic Mass | 338.17294 |
| SMILES | CCCCC/C=C/C1=CC(=O)[C@H](O)[C@@](O)(C/C=C(\C)C(=O)O)[C@@H]1O |
| InChI | InChI=1S/C18H26O6/c1-3-4-5-6-7-8-13-11-14(19)16(21)18(24,15(13)20)10-9-12(2)17(22)23/h7-9,11,15-16,20-21,24H,3-6,10H2,1-2H3,(H,22,23)/b8-7+,12-9+/t15-,16+,18-/m1/s1 |
| InChIKey | KUKDHFMUSAZTFT-VUJWGYGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pestalotiopsis (ncbitaxon:37840) | - | PubMed (28463686) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pestalic acid C (CHEBI:214897) is a hydroxy fatty acid (CHEBI:24654) |
| IUPAC Name |
|---|
| (E)-4-[(1R,2R,6R)-3-[(E)-hept-1-enyl]-1,2,6-trihydroxy-5-oxocyclohex-3-en-1-yl]-2-methylbut-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442158 | ChemSpider |