EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O7 |
| Net Charge | 0 |
| Average Mass | 404.459 |
| Monoisotopic Mass | 404.18350 |
| SMILES | CCCCCCC[C@@]1(O)CC2=C(CO1)C(=O)c1c(cc(OC)c(OC)c1O)C2=O |
| InChI | InChI=1S/C22H28O7/c1-4-5-6-7-8-9-22(26)11-14-15(12-29-22)19(24)17-13(18(14)23)10-16(27-2)21(28-3)20(17)25/h10,25-26H,4-9,11-12H2,1-3H3/t22-/m0/s1 |
| InChIKey | PWYCHAUTZXWZHW-QFIPXVFZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phomatospora bellaminuta (ncbitaxon:561985) | - | PubMed (21643520) |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Delitzchianone A (CHEBI:214860) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| 3-heptyl-3,9-dihydroxy-7,8-dimethoxy-1,4-dihydrobenzo[g]isochromene-5,10-dione |
| Manual Xrefs | Databases |
|---|---|
| 28288611 | ChemSpider |