EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H54N6O9 |
| Net Charge | 0 |
| Average Mass | 750.894 |
| Monoisotopic Mass | 750.39523 |
| SMILES | CCCCCCCC(N)C(O)C(=O)NC(C(=O)N1CCCC1C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(Cc1cc2ccccc2n1)C(=O)O)C(C)O |
| InChI | InChI=1S/C39H54N6O9/c1-3-4-5-6-7-12-28(40)34(48)37(51)44-33(23(2)46)38(52)45-19-10-14-32(45)36(50)42-30(20-24-15-17-27(47)18-16-24)35(49)43-31(39(53)54)22-26-21-25-11-8-9-13-29(25)41-26/h8-9,11,13,15-18,21,23,28,30-34,41,46-48H,3-7,10,12,14,19-20,22,40H2,1-2H3,(H,42,50)(H,43,49)(H,44,51)(H,53,54) |
| InChIKey | MCMDDENRFTYQNV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystisspecies (ncbitaxon:1127) | - | PubMed (16678305) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microginin FR9 (CHEBI:214818) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-[[2-[[1-[2-[(3-amino-2-hydroxydecanoyl)amino]-3-hydroxybutanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-indol-2-yl)propanoic acid |