EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H59N5O10 |
| Net Charge | 0 |
| Average Mass | 757.926 |
| Monoisotopic Mass | 757.42619 |
| SMILES | CCCCCCCC(N)C(O)C(=O)NC(C(=O)N(C)C(CC(C)C)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(Cc1ccc(O)cc1)C(=O)O)C(C)O |
| InChI | InChI=1S/C39H59N5O10/c1-6-7-8-9-10-11-29(40)34(48)37(51)43-33(24(4)45)38(52)44(5)32(20-23(2)3)36(50)41-30(21-25-12-16-27(46)17-13-25)35(49)42-31(39(53)54)22-26-14-18-28(47)19-15-26/h12-19,23-24,29-34,45-48H,6-11,20-22,40H2,1-5H3,(H,41,50)(H,42,49)(H,43,51)(H,53,54) |
| InChIKey | FXNVBPMPLYGNFO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystisspecies (ncbitaxon:1127) | - | PubMed (16678305) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microginin 757 (CHEBI:214808) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-[[2-[[2-[[2-[(3-amino-2-hydroxydecanoyl)amino]-3-hydroxybutanoyl]-methylamino]-4-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |