EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H39NO8 |
| Net Charge | 0 |
| Average Mass | 517.619 |
| Monoisotopic Mass | 517.26757 |
| SMILES | COc1c(C)c(OC[C@@H]2[C@@]3(C)CCCC(C)(C)[C@@H]3CC[C@@]2(C)O)c2c(c1C(=O)O)CN(CC(=O)O)C2=O |
| InChI | InChI=1S/C28H39NO8/c1-15-22(36-6)21(25(33)34)16-12-29(13-19(30)31)24(32)20(16)23(15)37-14-18-27(4)10-7-9-26(2,3)17(27)8-11-28(18,5)35/h17-18,35H,7-14H2,1-6H3,(H,30,31)(H,33,34)/t17-,18+,27-,28+/m0/s1 |
| InChIKey | PXDWLLNSVIWIRA-UZLXAVLXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypoxylon (ncbitaxon:42308) | - | PubMed (28384525) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fendlerinine B (CHEBI:214805) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 7-[[(1S,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]-2-(carboxymethyl)-5-methoxy-6-methyl-1-oxo-3H-isoindole-4-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442153 | ChemSpider |