EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O8 |
| Net Charge | 0 |
| Average Mass | 320.253 |
| Monoisotopic Mass | 320.05322 |
| SMILES | COc1cc(O)c(C(=O)O)c(-c2c(C)cc(C(=O)O)oc2=O)c1 |
| InChI | InChI=1S/C15H12O8/c1-6-3-10(13(17)18)23-15(21)11(6)8-4-7(22-2)5-9(16)12(8)14(19)20/h3-5,16H,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | DTWGKAWUEOJXKI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycobacterium tuberculosis (ncbitaxon:1773) | - | DOI (10.1016/s0040-4020(01)83496-7) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Alternarian acid (CHEBI:214769) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 5-(2-carboxy-3-hydroxy-5-methoxyphenyl)-4-methyl-6-oxopyran-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 22369675 | ChemSpider |