EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18N4O6 |
| Net Charge | 0 |
| Average Mass | 290.276 |
| Monoisotopic Mass | 290.12263 |
| SMILES | N=C(NCCC[C@H](N)C(=O)O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H18N4O6/c11-5(8(17)18)2-1-3-13-10(12)14-6(9(19)20)4-7(15)16/h5-6H,1-4,11H2,(H,15,16)(H,17,18)(H,19,20)(H3,12,13,14)/t5-,6?/m0/s1 |
| InChIKey | KDZOASGQNOPSCU-ZBHICJROSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Nω-L-arginino)succinic acid (CHEBI:15682) has role Escherichia coli metabolite (CHEBI:76971) |
| (Nω-L-arginino)succinic acid (CHEBI:15682) has role mouse metabolite (CHEBI:75771) |
| (Nω-L-arginino)succinic acid (CHEBI:15682) is a L-arginine derivative (CHEBI:83965) |
| (Nω-L-arginino)succinic acid (CHEBI:15682) is a guanidines (CHEBI:24436) |
| (Nω-L-arginino)succinic acid (CHEBI:15682) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| (Nω-L-arginino)succinic acid (CHEBI:15682) is conjugate acid of (Nω-L-arginino)succinate(1−) (CHEBI:57472) |
| Incoming Relation(s) |
| (Nω-L-arginino)succinate(1−) (CHEBI:57472) is conjugate base of (Nω-L-arginino)succinic acid (CHEBI:15682) |
| IUPAC Name |
|---|
| 2-(Nω-L-arginino)butanedioic acid |
| Synonyms | Source |
|---|---|
| 2-(Nomega-L-Arginino)succinate | KEGG COMPOUND |
| L-argininosuccinate | ChEBI |
| L-Argininosuccinate | KEGG COMPOUND |
| L-argininosuccinic acid | ChEBI |
| L-Argininosuccinic acid | KEGG COMPOUND |
| L-arginosuccinic acid | ChEBI |