EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32N2O13 |
| Net Charge | 0 |
| Average Mass | 508.477 |
| Monoisotopic Mass | 508.19044 |
| SMILES | COC1=C(N[C@H](C(=O)O)[C@@H](C)O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)C[C@](O)(CO)CC1=NCC(=O)O |
| InChI | InChI=1S/C20H32N2O13/c1-8(34-19-16(29)15(28)14(27)11(6-23)35-19)13(18(30)31)22-10-4-20(32,7-24)3-9(17(10)33-2)21-5-12(25)26/h8,11,13-16,19,22-24,27-29,32H,3-7H2,1-2H3,(H,25,26)(H,30,31)/t8-,11-,13+,14+,15+,16-,19-,20+/m1/s1 |
| InChIKey | TVAHPFBWVIRAPV-CQRDSGTRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nostocspeciesaericum (ncbitaxon:217115) | - | PubMed (28544967) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-O-(beta-galactosyl)-porphyra-334 (CHEBI:214747) is a glyco-amino acid (CHEBI:35258) |
| IUPAC Name |
|---|
| (2S,3R)-2-[[(5R)-3-(carboxymethylimino)-5-hydroxy-5-(hydroxymethyl)-2-methoxycyclohexen-1-yl]amino]-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoic acid |