EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N7O8S |
| Net Charge | 0 |
| Average Mass | 395.354 |
| Monoisotopic Mass | 395.08593 |
| SMILES | N=C1N(O)[C@@H](COC(=O)NS(=O)(=O)O)[C@@H]2N=C(N)N[C@]23N1CCC3(O)O |
| InChI | InChI=1S/C10H17N7O8S/c11-6-13-5-4(3-25-8(18)15-26(22,23)24)17(21)7(12)16-2-1-9(19,20)10(5,16)14-6/h4-5,12,19-21H,1-3H2,(H,15,18)(H3,11,13,14)(H,22,23,24)/t4-,5-,10-/m0/s1 |
| InChIKey | ALRRPAKWGUBPBK-HGRQIUPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cylindrospermopsis raciborskii (ncbitaxon:77022) | - | PubMed (30471380) |
| Roles Classification |
|---|
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gonyautoxin-6 (CHEBI:214686) has role marine metabolite (CHEBI:76507) |
| Gonyautoxin-6 (CHEBI:214686) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| [(3aS,4R,10aS)-2-amino-5,10,10-trihydroxy-6-imino-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methoxycarbonylsulamic acid |
| Manual Xrefs | Databases |
|---|---|
| 30790889 | ChemSpider |