EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O4 |
| Net Charge | 0 |
| Average Mass | 266.337 |
| Monoisotopic Mass | 266.15181 |
| SMILES | CC1=CC[C@@H]2[C@](C)(CCC[C@]2(C)C(=O)O)[C@H]1C(=O)O |
| InChI | InChI=1S/C15H22O4/c1-9-5-6-10-14(2,11(9)12(16)17)7-4-8-15(10,3)13(18)19/h5,10-11H,4,6-8H2,1-3H3,(H,16,17)(H,18,19)/t10-,11-,14+,15+/m1/s1 |
| InChIKey | AYUMAVFCZFWXOW-FIXIBIHLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arecophila (ncbitaxon:189360) | - | PubMed (23079766) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arecoic acid F (CHEBI:214656) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| (1S,4aR,5S,8aS)-2,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalene-1,5-dicarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442359 | ChemSpider |