EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H45ClN4O7 |
| Net Charge | 0 |
| Average Mass | 585.142 |
| Monoisotopic Mass | 584.29768 |
| SMILES | CC(C)[C@@H](C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)N(C)C(=O)[C@H](C)NC(=O)[C@@H](O)[C@@H](N)CCCCCCCCl |
| InChI | InChI=1S/C28H45ClN4O7/c1-17(2)23(25(36)32-22(28(39)40)16-19-11-13-20(34)14-12-19)33(4)27(38)18(3)31-26(37)24(35)21(30)10-8-6-5-7-9-15-29/h11-14,17-18,21-24,34-35H,5-10,15-16,30H2,1-4H3,(H,31,37)(H,32,36)(H,39,40)/t18-,21-,22-,23-,24-/m0/s1 |
| InChIKey | IZEUJLTUOBKQOT-NHKCCNDQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystisspecies (ncbitaxon:1127) | - | DOI (10.1016/j.tet.2008.05.031) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microginin AL584 (CHEBI:214653) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S,3S)-3-amino-10-chloro-2-hydroxydecanoyl]amino]propanoyl]-methylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78438067 | ChemSpider |