EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20O2 |
| Net Charge | 0 |
| Average Mass | 184.279 |
| Monoisotopic Mass | 184.14633 |
| SMILES | CCCCC[C@@H](C)/C=C(\C)C(=O)O |
| InChI | InChI=1S/C11H20O2/c1-4-5-6-7-9(2)8-10(3)11(12)13/h8-9H,4-7H2,1-3H3,(H,12,13)/b10-8+/t9-/m1/s1 |
| InChIKey | DGIYLPWYXMMVDH-NCXKZPMSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camaropsspecies (ncbitaxon:1933436) | - | DOI (10.1016/j.phytol.2016.08.007) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,4R)-2,4-dimethylnon-2-enoic acid (CHEBI:214581) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (E,4R)-2,4-dimethylnon-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442253 | ChemSpider |