EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14O6 |
| Net Charge | 0 |
| Average Mass | 266.249 |
| Monoisotopic Mass | 266.07904 |
| SMILES | COC(=O)c1ccc(O)c2c1[C@H](OC)[C@@H](C)OC2=O |
| InChI | InChI=1S/C13H14O6/c1-6-11(17-2)9-7(12(15)18-3)4-5-8(14)10(9)13(16)19-6/h4-6,11,14H,1-3H3/t6-,11-/m1/s1 |
| InChIKey | IHELZRODRRMQFZ-KSBSHMNSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria mali (ncbitaxon:114819) | - | DOI (10.1007/s10600-020-02992-6) |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xylariamalirin (CHEBI:214549) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| methyl (3R,4S)-8-hydroxy-4-methoxy-3-methyl-1-oxo-3,4-dihydroisochromene-5-carboxylate |